C19H19F3O4S — CID 10668678
ethyl (1R,2R,3R,4S)-3-[(E)-2-phenylethenyl]-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 10668678) has the molecular formula C19H19F3O4S and a molecular weight of 400.42 g/mol. Its IUPAC name is ethyl (1R,2R,3R,4S)-3-[(E)-2-phenylethenyl]-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,3R,4S)-3-[(E)-2-phenylethenyl]-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10668678 |
| Molecular Formula | C19H19F3O4S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | ethyl (1R,2R,3R,4S)-3-[(E)-2-phenylethenyl]-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(S(=O)(=O)C(F)(F)F)[C@H](/C=C/c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C19H19F3O4S/c1-2-26-17(23)18(27(24,25)19(20,21)22)15-10-9-14(12-15)16(18)11-8-13-6-4-3-5-7-13/h3-11,14-16H,2,12H2,1H3/b11-8+/t14-,15+,16-,18-/m1/s1 |
| InChIKey | JAFLRTWJPDXQOV-LJZWYQAJSA-N |
| XLogP | 3.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|