C17H16F4O4S — CID 10620516
ethyl (1R,2R,3S,4S)-3-(4-fluorophenyl)-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 10620516) has the molecular formula C17H16F4O4S and a molecular weight of 392.37 g/mol. Its IUPAC name is ethyl (1R,2R,3S,4S)-3-(4-fluorophenyl)-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,3S,4S)-3-(4-fluorophenyl)-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10620516 |
| Molecular Formula | C17H16F4O4S |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | ethyl (1R,2R,3S,4S)-3-(4-fluorophenyl)-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(S(=O)(=O)C(F)(F)F)[C@H](c2ccc(F)cc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H16F4O4S/c1-2-25-15(22)16(26(23,24)17(19,20)21)12-6-3-11(9-12)14(16)10-4-7-13(18)8-5-10/h3-8,11-12,14H,2,9H2,1H3/t11-,12+,14-,16-/m1/s1 |
| InChIKey | MRUCOUKMDDSIJH-FAXLKDOZSA-N |
| XLogP | 3.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|