C12H11F2O5S- — CID 58372259
2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoroethanesulfonate (PubChem CID 58372259) has the molecular formula C12H11F2O5S- and a molecular weight of 305.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoroethanesulfonate.
| Compound Name | 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 58372259 |
| Molecular Formula | C12H11F2O5S- |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-(2,3-dihydro-1H-indene-2-carbonyloxy)-1,1-difluoroethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])C1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H12F2O5S/c13-12(14,20(16,17)18)7-19-11(15)10-5-8-3-1-2-4-9(8)6-10/h1-4,10H,5-7H2,(H,16,17,18)/p-1 |
| InChIKey | PWBRDXWJRPFOGY-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|