C20H16F10O4S — CID 10674045
ethyl (1R,2R,3S,4S)-3-(4-fluorophenyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 10674045) has the molecular formula C20H16F10O4S and a molecular weight of 542.39 g/mol. Its IUPAC name is ethyl (1R,2R,3S,4S)-3-(4-fluorophenyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,3S,4S)-3-(4-fluorophenyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10674045 |
| Molecular Formula | C20H16F10O4S |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | ethyl (1R,2R,3S,4S)-3-(4-fluorophenyl)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@H](c2ccc(F)cc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C20H16F10O4S/c1-2-34-15(31)16(12-6-3-11(9-12)14(16)10-4-7-13(21)8-5-10)35(32,33)20(29,30)18(24,25)17(22,23)19(26,27)28/h3-8,11-12,14H,2,9H2,1H3/t11-,12+,14-,16-/m1/s1 |
| InChIKey | BTWVUDUBRFPGSD-FAXLKDOZSA-N |
| XLogP | 5.26 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|