C20H17F9O4S — CID 23236902
ethyl (1R,2R,3S,4S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 23236902) has the molecular formula C20H17F9O4S and a molecular weight of 524.40 g/mol. Its IUPAC name is ethyl (1R,2R,3S,4S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,3S,4S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 23236902 |
| Molecular Formula | C20H17F9O4S |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | ethyl (1R,2R,3S,4S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@H](c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C20H17F9O4S/c1-2-33-15(30)16(13-9-8-12(10-13)14(16)11-6-4-3-5-7-11)34(31,32)20(28,29)18(23,24)17(21,22)19(25,26)27/h3-9,12-14H,2,10H2,1H3/t12-,13+,14-,16-/m1/s1 |
| InChIKey | RZHGQMRKSTXLGJ-HLPPOEQASA-N |
| XLogP | 5.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|