C17H17F3O4S — CID 10809395
ethyl (1R,2R,3S,4S)-3-phenyl-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 10809395) has the molecular formula C17H17F3O4S and a molecular weight of 374.38 g/mol. Its IUPAC name is ethyl (1R,2R,3S,4S)-3-phenyl-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,3S,4S)-3-phenyl-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10809395 |
| Molecular Formula | C17H17F3O4S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | ethyl (1R,2R,3S,4S)-3-phenyl-2-(trifluoromethylsulfonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(S(=O)(=O)C(F)(F)F)[C@H](c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H17F3O4S/c1-2-24-15(21)16(25(22,23)17(18,19)20)13-9-8-12(10-13)14(16)11-6-4-3-5-7-11/h3-9,12-14H,2,10H2,1H3/t12-,13+,14-,16-/m1/s1 |
| InChIKey | XICFYPIAKDFAFO-HLPPOEQASA-N |
| XLogP | 3.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|