C13H15F3O4S — CID 15237401
ethyl (2R)-4-phenyl-2-(trifluoromethylsulfonyl)butanoate (PubChem CID 15237401) has the molecular formula C13H15F3O4S and a molecular weight of 324.32 g/mol. Its IUPAC name is ethyl (2R)-4-phenyl-2-(trifluoromethylsulfonyl)butanoate.
| Compound Name | ethyl (2R)-4-phenyl-2-(trifluoromethylsulfonyl)butanoate |
|---|---|
| PubChem CID | 15237401 |
| Molecular Formula | C13H15F3O4S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | ethyl (2R)-4-phenyl-2-(trifluoromethylsulfonyl)butanoate |
| SMILES | CCOC(=O)[C@@H](CCc1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O4S/c1-2-20-12(17)11(21(18,19)13(14,15)16)9-8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | CGHNLWWNLYVNJR-LLVKDONJSA-N |
| XLogP | 2.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |