C22H19F9O4S — CID 10697904
ethyl (1R,2R,3R,4S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-[(E)-2-phenylethenyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 10697904) has the molecular formula C22H19F9O4S and a molecular weight of 550.44 g/mol. Its IUPAC name is ethyl (1R,2R,3R,4S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-[(E)-2-phenylethenyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,3R,4S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-[(E)-2-phenylethenyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10697904 |
| Molecular Formula | C22H19F9O4S |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | ethyl (1R,2R,3R,4S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-3-[(E)-2-phenylethenyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@H](/C=C/c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C22H19F9O4S/c1-2-35-17(32)18(36(33,34)22(30,31)20(25,26)19(23,24)21(27,28)29)15-10-9-14(12-15)16(18)11-8-13-6-4-3-5-7-13/h3-11,14-16H,2,12H2,1H3/b11-8+/t14-,15+,16-,18-/m1/s1 |
| InChIKey | STLOTWDKUJZGCZ-LJZWYQAJSA-N |
| XLogP | 5.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|