C17H20F4O4S — CID 123881616
ethyl 4-(fluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylate (PubChem CID 123881616) has the molecular formula C17H20F4O4S and a molecular weight of 396.40 g/mol. Its IUPAC name is ethyl 4-(fluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(fluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123881616 |
| Molecular Formula | C17H20F4O4S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | ethyl 4-(fluoromethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(CF)(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H20F4O4S/c1-2-25-15(22)12-6-8-16(11-18,9-7-12)26(23,24)14-5-3-4-13(10-14)17(19,20)21/h3-5,10,12H,2,6-9,11H2,1H3 |
| InChIKey | CXDBLXMALIETCN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |