C20H20O8S — CID 10047747
dimethyl (1S,5S)-7-(benzenesulfonyl)-4-oxo-3-oxatricyclo[6.3.0.01,5]undec-7-ene-10,10-dicarboxylate (PubChem CID 10047747) has the molecular formula C20H20O8S and a molecular weight of 420.44 g/mol. Its IUPAC name is dimethyl (1S,5S)-7-(benzenesulfonyl)-4-oxo-3-oxatricyclo[6.3.0.01,5]undec-7-ene-10,10-dicarboxylate.
| Compound Name | dimethyl (1S,5S)-7-(benzenesulfonyl)-4-oxo-3-oxatricyclo[6.3.0.01,5]undec-7-ene-10,10-dicarboxylate |
|---|---|
| PubChem CID | 10047747 |
| Molecular Formula | C20H20O8S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | dimethyl (1S,5S)-7-(benzenesulfonyl)-4-oxo-3-oxatricyclo[6.3.0.01,5]undec-7-ene-10,10-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(S(=O)(=O)c3ccccc3)C[C@@H]3C(=O)OC[C@]23C1 |
| InChI | InChI=1S/C20H20O8S/c1-26-17(22)19(18(23)27-2)9-14-15(29(24,25)12-6-4-3-5-7-12)8-13-16(21)28-11-20(13,14)10-19/h3-7,13H,8-11H2,1-2H3/t13-,20+/m1/s1 |
| InChIKey | XWWDSEVMZWJATM-XCLFUZPHSA-N |
| XLogP | 1.40 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|