C27H32O8S — CID 164668400
diethyl 3-(benzenesulfonylmethyl)-4-[(4-methoxycarbonylphenyl)methyl]cyclopentane-1,1-dicarboxylate (PubChem CID 164668400) has the molecular formula C27H32O8S and a molecular weight of 516.61 g/mol. Its IUPAC name is diethyl 3-(benzenesulfonylmethyl)-4-[(4-methoxycarbonylphenyl)methyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-(benzenesulfonylmethyl)-4-[(4-methoxycarbonylphenyl)methyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 164668400 |
| Molecular Formula | C27H32O8S |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | diethyl 3-(benzenesulfonylmethyl)-4-[(4-methoxycarbonylphenyl)methyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(Cc2ccc(C(=O)OC)cc2)C(CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C27H32O8S/c1-4-34-25(29)27(26(30)35-5-2)16-21(15-19-11-13-20(14-12-19)24(28)33-3)22(17-27)18-36(31,32)23-9-7-6-8-10-23/h6-14,21-22H,4-5,15-18H2,1-3H3 |
| InChIKey | IWCMVGMXQODISN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|