C25H32F2O4S — CID 163297698
[6-[benzenesulfonyl(difluoro)methyl]-3,7-dimethyloctyl] 4-methylbenzoate (PubChem CID 163297698) has the molecular formula C25H32F2O4S and a molecular weight of 466.59 g/mol. Its IUPAC name is [6-[benzenesulfonyl(difluoro)methyl]-3,7-dimethyloctyl] 4-methylbenzoate.
| Compound Name | [6-[benzenesulfonyl(difluoro)methyl]-3,7-dimethyloctyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 163297698 |
| Molecular Formula | C25H32F2O4S |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [6-[benzenesulfonyl(difluoro)methyl]-3,7-dimethyloctyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCC(C)CCC(C(C)C)C(F)(F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H32F2O4S/c1-18(2)23(25(26,27)32(29,30)22-8-6-5-7-9-22)15-12-20(4)16-17-31-24(28)21-13-10-19(3)11-14-21/h5-11,13-14,18,20,23H,12,15-17H2,1-4H3 |
| InChIKey | NDOIYAXUUFJGLJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |