C29H24F8O5S — CID 122677024
methyl 3-fluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate (PubChem CID 122677024) has the molecular formula C29H24F8O5S and a molecular weight of 636.56 g/mol. Its IUPAC name is methyl 3-fluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate.
| Compound Name | methyl 3-fluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 122677024 |
| Molecular Formula | C29H24F8O5S |
| Molecular Weight | 636.56 g/mol |
| Exact Mass | 636.12 |
| IUPAC Name | methyl 3-fluoro-2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(F)c1COC(c1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H24F8O5S/c1-41-25(38)22-5-4-6-24(31)23(22)17-42-27(28(32,33)34,29(35,36)37)19-9-7-18(8-10-19)26(15-2-3-16-26)43(39,40)21-13-11-20(30)12-14-21/h4-14H,2-3,15-17H2,1H3 |
| InChIKey | FCOLYGOMJMZIQR-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |