C24H32O4S — CID 10884226
methyl 4-[(3,5-ditert-butylphenyl)methylsulfonylmethyl]benzoate (PubChem CID 10884226) has the molecular formula C24H32O4S and a molecular weight of 416.58 g/mol. Its IUPAC name is methyl 4-[(3,5-ditert-butylphenyl)methylsulfonylmethyl]benzoate.
| Compound Name | methyl 4-[(3,5-ditert-butylphenyl)methylsulfonylmethyl]benzoate |
|---|---|
| PubChem CID | 10884226 |
| Molecular Formula | C24H32O4S |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | methyl 4-[(3,5-ditert-butylphenyl)methylsulfonylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C24H32O4S/c1-23(2,3)20-12-18(13-21(14-20)24(4,5)6)16-29(26,27)15-17-8-10-19(11-9-17)22(25)28-7/h8-14H,15-16H2,1-7H3 |
| InChIKey | PRDWAVCNIRRUNX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |