C22H28O9S — CID 10479746
dimethyl 2-[(Z)-4-methoxycarbonyloxybut-2-enyl]-2-[2-(4-methylphenyl)sulfonylbut-3-enyl]propanedioate (PubChem CID 10479746) has the molecular formula C22H28O9S and a molecular weight of 468.52 g/mol. Its IUPAC name is dimethyl 2-[(Z)-4-methoxycarbonyloxybut-2-enyl]-2-[2-(4-methylphenyl)sulfonylbut-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[(Z)-4-methoxycarbonyloxybut-2-enyl]-2-[2-(4-methylphenyl)sulfonylbut-3-enyl]propanedioate |
|---|---|
| PubChem CID | 10479746 |
| Molecular Formula | C22H28O9S |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | dimethyl 2-[(Z)-4-methoxycarbonyloxybut-2-enyl]-2-[2-(4-methylphenyl)sulfonylbut-3-enyl]propanedioate |
| SMILES | C=CC(CC(C/C=C\COC(=O)OC)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H28O9S/c1-6-17(32(26,27)18-11-9-16(2)10-12-18)15-22(19(23)28-3,20(24)29-4)13-7-8-14-31-21(25)30-5/h6-12,17H,1,13-15H2,2-5H3/b8-7- |
| InChIKey | HDGGALDIZGMQCG-FPLPWBNLSA-N |
| XLogP | 2.78 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|