C17H22O5S — CID 139744885
ethyl 2-[5-(benzenesulfonylmethyl)oxan-2-yl]prop-2-enoate (PubChem CID 139744885) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is ethyl 2-[5-(benzenesulfonylmethyl)oxan-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[5-(benzenesulfonylmethyl)oxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139744885 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | ethyl 2-[5-(benzenesulfonylmethyl)oxan-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)C1CCC(CS(=O)(=O)c2ccccc2)CO1 |
| InChI | InChI=1S/C17H22O5S/c1-3-21-17(18)13(2)16-10-9-14(11-22-16)12-23(19,20)15-7-5-4-6-8-15/h4-8,14,16H,2-3,9-12H2,1H3 |
| InChIKey | UQMRLIYBQWXMGF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|