C15H20O4S — CID 14291365
5-(benzenesulfonyl)-6-tert-butyloxan-2-one (PubChem CID 14291365) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-6-tert-butyloxan-2-one.
| Compound Name | 5-(benzenesulfonyl)-6-tert-butyloxan-2-one |
|---|---|
| PubChem CID | 14291365 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-(benzenesulfonyl)-6-tert-butyloxan-2-one |
| SMILES | CC(C)(C)C1OC(=O)CCC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O4S/c1-15(2,3)14-12(9-10-13(16)19-14)20(17,18)11-7-5-4-6-8-11/h4-8,12,14H,9-10H2,1-3H3 |
| InChIKey | JKBZSINSBIUTSO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |