C22H24O4S — CID 135027406
[4-(benzenesulfonyl)-2-methyl-5-phenylpent-1-en-3-yl] 2-methylprop-2-enoate (PubChem CID 135027406) has the molecular formula C22H24O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-2-methyl-5-phenylpent-1-en-3-yl] 2-methylprop-2-enoate.
| Compound Name | [4-(benzenesulfonyl)-2-methyl-5-phenylpent-1-en-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135027406 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [4-(benzenesulfonyl)-2-methyl-5-phenylpent-1-en-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(=C)C)C(Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24O4S/c1-16(2)21(26-22(23)17(3)4)20(15-18-11-7-5-8-12-18)27(24,25)19-13-9-6-10-14-19/h5-14,20-21H,1,3,15H2,2,4H3 |
| InChIKey | RHKWXDLXQFCCCB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|