C23H34O6S — CID 135000565
ethyl (3R)-2-(benzenesulfonyl)-3-cyclohexyl-3-[(6S)-6-methyloxan-2-yl]oxypropanoate (PubChem CID 135000565) has the molecular formula C23H34O6S and a molecular weight of 438.59 g/mol. Its IUPAC name is ethyl (3R)-2-(benzenesulfonyl)-3-cyclohexyl-3-[(6S)-6-methyloxan-2-yl]oxypropanoate.
| Compound Name | ethyl (3R)-2-(benzenesulfonyl)-3-cyclohexyl-3-[(6S)-6-methyloxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 135000565 |
| Molecular Formula | C23H34O6S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | ethyl (3R)-2-(benzenesulfonyl)-3-cyclohexyl-3-[(6S)-6-methyloxan-2-yl]oxypropanoate |
| SMILES | CCOC(=O)C([C@H](OC1CCC[C@H](C)O1)C1CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H34O6S/c1-3-27-23(24)22(30(25,26)19-14-8-5-9-15-19)21(18-12-6-4-7-13-18)29-20-16-10-11-17(2)28-20/h5,8-9,14-15,17-18,20-22H,3-4,6-7,10-13,16H2,1-2H3/t17-,20?,21+,22?/m0/s1 |
| InChIKey | PWVQZNSUTGSCGN-MPWLDHFDSA-N |
| XLogP | 4.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |