C17H26O6S — CID 134916491
methyl (3R,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3,5-dimethylhexanoate (PubChem CID 134916491) has the molecular formula C17H26O6S and a molecular weight of 358.46 g/mol. Its IUPAC name is methyl (3R,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3,5-dimethylhexanoate.
| Compound Name | methyl (3R,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3,5-dimethylhexanoate |
|---|---|
| PubChem CID | 134916491 |
| Molecular Formula | C17H26O6S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | methyl (3R,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3,5-dimethylhexanoate |
| SMILES | COCO[C@@H](C(C)C)[C@@H](C)C(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26O6S/c1-12(2)15(23-11-21-4)13(3)16(17(18)22-5)24(19,20)14-9-7-6-8-10-14/h6-10,12-13,15-16H,11H2,1-5H3/t13-,15+,16?/m1/s1 |
| InChIKey | UDZXJKXFPCEICZ-YISXUXMPSA-N |
| XLogP | 2.28 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|