C17H24O3S — CID 11781812
(4S,5S)-4-(hydroxymethyl)-5-pentyl-3-(phenylsulfanylmethyl)oxolan-2-one (PubChem CID 11781812) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is (4S,5S)-4-(hydroxymethyl)-5-pentyl-3-(phenylsulfanylmethyl)oxolan-2-one.
| Compound Name | (4S,5S)-4-(hydroxymethyl)-5-pentyl-3-(phenylsulfanylmethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11781812 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (4S,5S)-4-(hydroxymethyl)-5-pentyl-3-(phenylsulfanylmethyl)oxolan-2-one |
| SMILES | CCCCC[C@@H]1OC(=O)C(CSc2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C17H24O3S/c1-2-3-5-10-16-14(11-18)15(17(19)20-16)12-21-13-8-6-4-7-9-13/h4,6-9,14-16,18H,2-3,5,10-12H2,1H3/t14-,15?,16+/m1/s1 |
| InChIKey | CMLHISQJJKKXJC-TUOGLVOQSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|