C18H20O6S — CID 15732241
dimethyl 3-(benzenesulfonylmethyl)-4-ethenylcyclopent-2-ene-1,1-dicarboxylate (PubChem CID 15732241) has the molecular formula C18H20O6S and a molecular weight of 364.42 g/mol. Its IUPAC name is dimethyl 3-(benzenesulfonylmethyl)-4-ethenylcyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(benzenesulfonylmethyl)-4-ethenylcyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15732241 |
| Molecular Formula | C18H20O6S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | dimethyl 3-(benzenesulfonylmethyl)-4-ethenylcyclopent-2-ene-1,1-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OC)(C(=O)OC)C=C1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O6S/c1-4-13-10-18(16(19)23-2,17(20)24-3)11-14(13)12-25(21,22)15-8-6-5-7-9-15/h4-9,11,13H,1,10,12H2,2-3H3 |
| InChIKey | KHSPXKHQKAISCP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|