C18H22F2O6S — CID 163297668
diethyl 3-[benzenesulfonyl(difluoro)methyl]cyclopentane-1,1-dicarboxylate (PubChem CID 163297668) has the molecular formula C18H22F2O6S and a molecular weight of 404.43 g/mol. Its IUPAC name is diethyl 3-[benzenesulfonyl(difluoro)methyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-[benzenesulfonyl(difluoro)methyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 163297668 |
| Molecular Formula | C18H22F2O6S |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | diethyl 3-[benzenesulfonyl(difluoro)methyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC(C(F)(F)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H22F2O6S/c1-3-25-15(21)17(16(22)26-4-2)11-10-13(12-17)18(19,20)27(23,24)14-8-6-5-7-9-14/h5-9,13H,3-4,10-12H2,1-2H3 |
| InChIKey | GINGNZIZAZBUMR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|