C20H26F2O6S — CID 25135352
diethyl 2-[2,2-difluoro-3,3-dimethyl-1-[(4-methylphenyl)sulfonylmethyl]cyclopropyl]propanedioate (PubChem CID 25135352) has the molecular formula C20H26F2O6S and a molecular weight of 432.49 g/mol. Its IUPAC name is diethyl 2-[2,2-difluoro-3,3-dimethyl-1-[(4-methylphenyl)sulfonylmethyl]cyclopropyl]propanedioate.
| Compound Name | diethyl 2-[2,2-difluoro-3,3-dimethyl-1-[(4-methylphenyl)sulfonylmethyl]cyclopropyl]propanedioate |
|---|---|
| PubChem CID | 25135352 |
| Molecular Formula | C20H26F2O6S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | diethyl 2-[2,2-difluoro-3,3-dimethyl-1-[(4-methylphenyl)sulfonylmethyl]cyclopropyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1(CS(=O)(=O)c2ccc(C)cc2)C(C)(C)C1(F)F |
| InChI | InChI=1S/C20H26F2O6S/c1-6-27-16(23)15(17(24)28-7-2)19(18(4,5)20(19,21)22)12-29(25,26)14-10-8-13(3)9-11-14/h8-11,15H,6-7,12H2,1-5H3 |
| InChIKey | ZKLSUNPXAGTZRH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|