C20H23BrO6S — CID 134936687
diethyl 2-[(Z)-2-(benzenesulfonyl)-2-bromoethenyl]-2-cyclopent-2-en-1-ylpropanedioate (PubChem CID 134936687) has the molecular formula C20H23BrO6S and a molecular weight of 471.37 g/mol. Its IUPAC name is diethyl 2-[(Z)-2-(benzenesulfonyl)-2-bromoethenyl]-2-cyclopent-2-en-1-ylpropanedioate.
| Compound Name | diethyl 2-[(Z)-2-(benzenesulfonyl)-2-bromoethenyl]-2-cyclopent-2-en-1-ylpropanedioate |
|---|---|
| PubChem CID | 134936687 |
| Molecular Formula | C20H23BrO6S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | diethyl 2-[(Z)-2-(benzenesulfonyl)-2-bromoethenyl]-2-cyclopent-2-en-1-ylpropanedioate |
| SMILES | CCOC(=O)C(/C=C(\Br)S(=O)(=O)c1ccccc1)(C(=O)OCC)C1C=CCC1 |
| InChI | InChI=1S/C20H23BrO6S/c1-3-26-18(22)20(19(23)27-4-2,15-10-8-9-11-15)14-17(21)28(24,25)16-12-6-5-7-13-16/h5-8,10,12-15H,3-4,9,11H2,1-2H3/b17-14+ |
| InChIKey | ALVWZGZQKHWNJE-SAPNQHFASA-N |
| XLogP | 3.78 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|