C17H20O4S — CID 134916414
ethyl 1-(benzenesulfonyl)-2-prop-1-en-2-ylcyclopent-3-ene-1-carboxylate (PubChem CID 134916414) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl 1-(benzenesulfonyl)-2-prop-1-en-2-ylcyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl 1-(benzenesulfonyl)-2-prop-1-en-2-ylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134916414 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | ethyl 1-(benzenesulfonyl)-2-prop-1-en-2-ylcyclopent-3-ene-1-carboxylate |
| SMILES | C=C(C)C1C=CCC1(C(=O)OCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O4S/c1-4-21-16(18)17(12-8-11-15(17)13(2)3)22(19,20)14-9-6-5-7-10-14/h5-11,15H,2,4,12H2,1,3H3 |
| InChIKey | GNPVFRFTLFRNFZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|