C21H25BrO6S — CID 134937656
diethyl 2-[(Z)-2-(benzenesulfonyl)-2-bromoethenyl]-2-cyclohex-2-en-1-ylpropanedioate (PubChem CID 134937656) has the molecular formula C21H25BrO6S and a molecular weight of 485.40 g/mol. Its IUPAC name is diethyl 2-[(Z)-2-(benzenesulfonyl)-2-bromoethenyl]-2-cyclohex-2-en-1-ylpropanedioate.
| Compound Name | diethyl 2-[(Z)-2-(benzenesulfonyl)-2-bromoethenyl]-2-cyclohex-2-en-1-ylpropanedioate |
|---|---|
| PubChem CID | 134937656 |
| Molecular Formula | C21H25BrO6S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | diethyl 2-[(Z)-2-(benzenesulfonyl)-2-bromoethenyl]-2-cyclohex-2-en-1-ylpropanedioate |
| SMILES | CCOC(=O)C(/C=C(\Br)S(=O)(=O)c1ccccc1)(C(=O)OCC)C1C=CCCC1 |
| InChI | InChI=1S/C21H25BrO6S/c1-3-27-19(23)21(20(24)28-4-2,16-11-7-5-8-12-16)15-18(22)29(25,26)17-13-9-6-10-14-17/h6-7,9-11,13-16H,3-5,8,12H2,1-2H3/b18-15+ |
| InChIKey | HXADETGPDXWURF-OBGWFSINSA-N |
| XLogP | 4.17 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|