C18H27BrO6S — CID 134936946
diethyl 2-[(Z)-2-bromo-2-tert-butylsulfonylethenyl]-2-cyclopent-2-en-1-ylpropanedioate (PubChem CID 134936946) has the molecular formula C18H27BrO6S and a molecular weight of 451.38 g/mol. Its IUPAC name is diethyl 2-[(Z)-2-bromo-2-tert-butylsulfonylethenyl]-2-cyclopent-2-en-1-ylpropanedioate.
| Compound Name | diethyl 2-[(Z)-2-bromo-2-tert-butylsulfonylethenyl]-2-cyclopent-2-en-1-ylpropanedioate |
|---|---|
| PubChem CID | 134936946 |
| Molecular Formula | C18H27BrO6S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | diethyl 2-[(Z)-2-bromo-2-tert-butylsulfonylethenyl]-2-cyclopent-2-en-1-ylpropanedioate |
| SMILES | CCOC(=O)C(/C=C(\Br)S(=O)(=O)C(C)(C)C)(C(=O)OCC)C1C=CCC1 |
| InChI | InChI=1S/C18H27BrO6S/c1-6-24-15(20)18(16(21)25-7-2,13-10-8-9-11-13)12-14(19)26(22,23)17(3,4)5/h8,10,12-13H,6-7,9,11H2,1-5H3/b14-12+ |
| InChIKey | LDAIYSOGOZJYFU-WYMLVPIESA-N |
| XLogP | 3.51 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|