C19H24O5 — CID 173220438
ethyl 3-(2-cyclohex-2-en-1-yl-2-hydroxy-2-phenylacetyl)oxypropanoate (PubChem CID 173220438) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl 3-(2-cyclohex-2-en-1-yl-2-hydroxy-2-phenylacetyl)oxypropanoate.
| Compound Name | ethyl 3-(2-cyclohex-2-en-1-yl-2-hydroxy-2-phenylacetyl)oxypropanoate |
|---|---|
| PubChem CID | 173220438 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | ethyl 3-(2-cyclohex-2-en-1-yl-2-hydroxy-2-phenylacetyl)oxypropanoate |
| SMILES | CCOC(=O)CCOC(=O)C(O)(c1ccccc1)C1C=CCCC1 |
| InChI | InChI=1S/C19H24O5/c1-2-23-17(20)13-14-24-18(21)19(22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3,5-7,9-11,16,22H,2,4,8,12-14H2,1H3 |
| InChIKey | PRCAGNJXYPBFHJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|