C11H11Cl2NO4S — CID 3090384
ethyl N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]carbamate (PubChem CID 3090384) has the molecular formula C11H11Cl2NO4S and a molecular weight of 324.19 g/mol. Its IUPAC name is ethyl N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]carbamate.
| Compound Name | ethyl N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]carbamate |
|---|---|
| PubChem CID | 3090384 |
| Molecular Formula | C11H11Cl2NO4S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | ethyl N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]carbamate |
| SMILES | CCOC(=O)NC(=C(Cl)Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11Cl2NO4S/c1-2-18-11(15)14-10(9(12)13)19(16,17)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,14,15) |
| InChIKey | OTZMVXQQPARVFD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |