C23H24O8S2 — CID 135061513
dimethyl (4S)-3,3-bis(benzenesulfonyl)-4-ethenylcyclopentane-1,1-dicarboxylate (PubChem CID 135061513) has the molecular formula C23H24O8S2 and a molecular weight of 492.57 g/mol. Its IUPAC name is dimethyl (4S)-3,3-bis(benzenesulfonyl)-4-ethenylcyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4S)-3,3-bis(benzenesulfonyl)-4-ethenylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135061513 |
| Molecular Formula | C23H24O8S2 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | dimethyl (4S)-3,3-bis(benzenesulfonyl)-4-ethenylcyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OC)CC1(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24O8S2/c1-4-17-15-22(20(24)30-2,21(25)31-3)16-23(17,32(26,27)18-11-7-5-8-12-18)33(28,29)19-13-9-6-10-14-19/h4-14,17H,1,15-16H2,2-3H3/t17-/m1/s1 |
| InChIKey | DVUTWFHXSWXLGM-QGZVFWFLSA-N |
| XLogP | 2.56 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|