C31H32O12S2 — CID 135064990
tetramethyl 3,9-bis(benzenesulfonyl)undeca-1,2,9,10-tetraene-4,4,6,6-tetracarboxylate (PubChem CID 135064990) has the molecular formula C31H32O12S2 and a molecular weight of 660.72 g/mol. Its IUPAC name is tetramethyl 3,9-bis(benzenesulfonyl)undeca-1,2,9,10-tetraene-4,4,6,6-tetracarboxylate.
| Compound Name | tetramethyl 3,9-bis(benzenesulfonyl)undeca-1,2,9,10-tetraene-4,4,6,6-tetracarboxylate |
|---|---|
| PubChem CID | 135064990 |
| Molecular Formula | C31H32O12S2 |
| Molecular Weight | 660.72 g/mol |
| Exact Mass | 660.13 |
| IUPAC Name | tetramethyl 3,9-bis(benzenesulfonyl)undeca-1,2,9,10-tetraene-4,4,6,6-tetracarboxylate |
| SMILES | C=C=C(CC(CC(CC(=C=C)S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H32O12S2/c1-7-22(44(36,37)24-15-11-9-12-16-24)19-30(26(32)40-3,27(33)41-4)21-31(28(34)42-5,29(35)43-6)20-23(8-2)45(38,39)25-17-13-10-14-18-25/h9-18H,1-2,19-21H2,3-6H3 |
| InChIKey | VFWCQYNYHCZNNX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|