C26H28O6S — CID 139094588
dimethyl (5S)-3-(4-methylphenyl)sulfonyl-4-phenyl-5-prop-1-en-2-ylcyclohex-3-ene-1,1-dicarboxylate (PubChem CID 139094588) has the molecular formula C26H28O6S and a molecular weight of 468.57 g/mol. Its IUPAC name is dimethyl (5S)-3-(4-methylphenyl)sulfonyl-4-phenyl-5-prop-1-en-2-ylcyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl (5S)-3-(4-methylphenyl)sulfonyl-4-phenyl-5-prop-1-en-2-ylcyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139094588 |
| Molecular Formula | C26H28O6S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | dimethyl (5S)-3-(4-methylphenyl)sulfonyl-4-phenyl-5-prop-1-en-2-ylcyclohex-3-ene-1,1-dicarboxylate |
| SMILES | C=C(C)[C@@H]1CC(C(=O)OC)(C(=O)OC)CC(S(=O)(=O)c2ccc(C)cc2)=C1c1ccccc1 |
| InChI | InChI=1S/C26H28O6S/c1-17(2)21-15-26(24(27)31-4,25(28)32-5)16-22(23(21)19-9-7-6-8-10-19)33(29,30)20-13-11-18(3)12-14-20/h6-14,21H,1,15-16H2,2-5H3/t21-/m0/s1 |
| InChIKey | SMUFFILSPYKDOL-NRFANRHFSA-N |
| XLogP | 4.50 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|