C24H26O8S2 — CID 10029215
dimethyl 2-[(Z)-3,4-bis(benzenesulfonyl)but-2-enyl]-2-prop-2-enylpropanedioate (PubChem CID 10029215) has the molecular formula C24H26O8S2 and a molecular weight of 506.60 g/mol. Its IUPAC name is dimethyl 2-[(Z)-3,4-bis(benzenesulfonyl)but-2-enyl]-2-prop-2-enylpropanedioate.
| Compound Name | dimethyl 2-[(Z)-3,4-bis(benzenesulfonyl)but-2-enyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 10029215 |
| Molecular Formula | C24H26O8S2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | dimethyl 2-[(Z)-3,4-bis(benzenesulfonyl)but-2-enyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C/C=C(/CS(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H26O8S2/c1-4-16-24(22(25)31-2,23(26)32-3)17-15-21(34(29,30)20-13-9-6-10-14-20)18-33(27,28)19-11-7-5-8-12-19/h4-15H,1,16-18H2,2-3H3/b21-15- |
| InChIKey | GDJQCDIUXUOQDX-QNGOZBTKSA-N |
| XLogP | 3.12 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|