C21H23NO6S2 — CID 90814169
ethyl 4-(benzenesulfonyl)-2-[2-(benzenesulfonyl)ethyl]-2-cyanobutanoate (PubChem CID 90814169) has the molecular formula C21H23NO6S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is ethyl 4-(benzenesulfonyl)-2-[2-(benzenesulfonyl)ethyl]-2-cyanobutanoate.
| Compound Name | ethyl 4-(benzenesulfonyl)-2-[2-(benzenesulfonyl)ethyl]-2-cyanobutanoate |
|---|---|
| PubChem CID | 90814169 |
| Molecular Formula | C21H23NO6S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | ethyl 4-(benzenesulfonyl)-2-[2-(benzenesulfonyl)ethyl]-2-cyanobutanoate |
| SMILES | CCOC(=O)C(C#N)(CCS(=O)(=O)c1ccccc1)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23NO6S2/c1-2-28-20(23)21(17-22,13-15-29(24,25)18-9-5-3-6-10-18)14-16-30(26,27)19-11-7-4-8-12-19/h3-12H,2,13-16H2,1H3 |
| InChIKey | SIUNDHAUEDHPPZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 118.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |