C23H27NO6S2 — CID 11691460
ethyl 2-[2,2-bis(benzenesulfonyl)ethyl]-2-cyanohexanoate (PubChem CID 11691460) has the molecular formula C23H27NO6S2 and a molecular weight of 477.60 g/mol. Its IUPAC name is ethyl 2-[2,2-bis(benzenesulfonyl)ethyl]-2-cyanohexanoate.
| Compound Name | ethyl 2-[2,2-bis(benzenesulfonyl)ethyl]-2-cyanohexanoate |
|---|---|
| PubChem CID | 11691460 |
| Molecular Formula | C23H27NO6S2 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | ethyl 2-[2,2-bis(benzenesulfonyl)ethyl]-2-cyanohexanoate |
| SMILES | CCCCC(C#N)(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C23H27NO6S2/c1-3-5-16-23(18-24,22(25)30-4-2)17-21(31(26,27)19-12-8-6-9-13-19)32(28,29)20-14-10-7-11-15-20/h6-15,21H,3-5,16-17H2,1-2H3 |
| InChIKey | GYNJITCKTGUWFH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 118.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |