C19H18FNO4S — CID 58591888
ethyl 4-(benzenesulfonyl)-2-cyano-2-(4-fluorophenyl)butanoate (PubChem CID 58591888) has the molecular formula C19H18FNO4S and a molecular weight of 375.42 g/mol. Its IUPAC name is ethyl 4-(benzenesulfonyl)-2-cyano-2-(4-fluorophenyl)butanoate.
| Compound Name | ethyl 4-(benzenesulfonyl)-2-cyano-2-(4-fluorophenyl)butanoate |
|---|---|
| PubChem CID | 58591888 |
| Molecular Formula | C19H18FNO4S |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | ethyl 4-(benzenesulfonyl)-2-cyano-2-(4-fluorophenyl)butanoate |
| SMILES | CCOC(=O)C(C#N)(CCS(=O)(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FNO4S/c1-2-25-18(22)19(14-21,15-8-10-16(20)11-9-15)12-13-26(23,24)17-6-4-3-5-7-17/h3-11H,2,12-13H2,1H3 |
| InChIKey | VAJBHUNGVAPEBR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |