C21H24O6S2 — CID 132556218
(3S,4R)-3-[2,2-bis(benzenesulfonyl)ethyl]-4-ethyloxan-2-one (PubChem CID 132556218) has the molecular formula C21H24O6S2 and a molecular weight of 436.55 g/mol. Its IUPAC name is (3S,4R)-3-[2,2-bis(benzenesulfonyl)ethyl]-4-ethyloxan-2-one.
| Compound Name | (3S,4R)-3-[2,2-bis(benzenesulfonyl)ethyl]-4-ethyloxan-2-one |
|---|---|
| PubChem CID | 132556218 |
| Molecular Formula | C21H24O6S2 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (3S,4R)-3-[2,2-bis(benzenesulfonyl)ethyl]-4-ethyloxan-2-one |
| SMILES | CC[C@@H]1CCOC(=O)[C@H]1CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24O6S2/c1-2-16-13-14-27-21(22)19(16)15-20(28(23,24)17-9-5-3-6-10-17)29(25,26)18-11-7-4-8-12-18/h3-12,16,19-20H,2,13-15H2,1H3/t16-,19+/m1/s1 |
| InChIKey | WIWYBBJYUFXTJS-APWZRJJASA-N |
| XLogP | 3.24 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |