C17H19NO4S — CID 135035884
ethyl 2-[3-(benzenesulfonyl)prop-1-en-2-yl]-2-cyanopent-4-enoate (PubChem CID 135035884) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is ethyl 2-[3-(benzenesulfonyl)prop-1-en-2-yl]-2-cyanopent-4-enoate.
| Compound Name | ethyl 2-[3-(benzenesulfonyl)prop-1-en-2-yl]-2-cyanopent-4-enoate |
|---|---|
| PubChem CID | 135035884 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl 2-[3-(benzenesulfonyl)prop-1-en-2-yl]-2-cyanopent-4-enoate |
| SMILES | C=CCC(C#N)(C(=C)CS(=O)(=O)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C17H19NO4S/c1-4-11-17(13-18,16(19)22-5-2)14(3)12-23(20,21)15-9-7-6-8-10-15/h4,6-10H,1,3,5,11-12H2,2H3 |
| InChIKey | GKGFHCZUINGMJL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|