C20H21NO6S2 — CID 11690633
ethyl 4,4-bis(benzenesulfonyl)-2-cyano-2-methylbutanoate (PubChem CID 11690633) has the molecular formula C20H21NO6S2 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl 4,4-bis(benzenesulfonyl)-2-cyano-2-methylbutanoate.
| Compound Name | ethyl 4,4-bis(benzenesulfonyl)-2-cyano-2-methylbutanoate |
|---|---|
| PubChem CID | 11690633 |
| Molecular Formula | C20H21NO6S2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | ethyl 4,4-bis(benzenesulfonyl)-2-cyano-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)(C#N)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO6S2/c1-3-27-19(22)20(2,15-21)14-18(28(23,24)16-10-6-4-7-11-16)29(25,26)17-12-8-5-9-13-17/h4-13,18H,3,14H2,1-2H3 |
| InChIKey | LQYDHIOCPCMUFP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 118.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |