C28H32F3NO6S3 — CID 159340957
3-(2,2-dimethylbutanoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide;triphenylsulfanium (PubChem CID 159340957) has the molecular formula C28H32F3NO6S3 and a molecular weight of 631.76 g/mol. Its IUPAC name is 3-(2,2-dimethylbutanoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide;triphenylsulfanium.
| Compound Name | 3-(2,2-dimethylbutanoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide;triphenylsulfanium |
|---|---|
| PubChem CID | 159340957 |
| Molecular Formula | C28H32F3NO6S3 |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.13 |
| IUPAC Name | 3-(2,2-dimethylbutanoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide;triphenylsulfanium |
| SMILES | CCC(C)(C)C(=O)OCCCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C10H17F3NO6S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-9(2,3)8(15)20-6-5-7-21(16,17)14-22(18,19)10(11,12)13/h1-15H;4-7H2,1-3H3/q+1;-1 |
| InChIKey | LGDCCNDZLSCOSL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|