C26H25NO6S2 — CID 11511836
ethyl 4,4-bis(benzenesulfonyl)-2-benzyl-2-cyanobutanoate (PubChem CID 11511836) has the molecular formula C26H25NO6S2 and a molecular weight of 511.62 g/mol. Its IUPAC name is ethyl 4,4-bis(benzenesulfonyl)-2-benzyl-2-cyanobutanoate.
| Compound Name | ethyl 4,4-bis(benzenesulfonyl)-2-benzyl-2-cyanobutanoate |
|---|---|
| PubChem CID | 11511836 |
| Molecular Formula | C26H25NO6S2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | ethyl 4,4-bis(benzenesulfonyl)-2-benzyl-2-cyanobutanoate |
| SMILES | CCOC(=O)C(C#N)(Cc1ccccc1)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25NO6S2/c1-2-33-25(28)26(20-27,18-21-12-6-3-7-13-21)19-24(34(29,30)22-14-8-4-9-15-22)35(31,32)23-16-10-5-11-17-23/h3-17,24H,2,18-19H2,1H3 |
| InChIKey | YCRJILGARHSVBW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 118.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |