C27H30O2S2 — CID 15501159
ethyl 2-(2-phenylethyl)-5,5-bis(phenylsulfanyl)pentanoate (PubChem CID 15501159) has the molecular formula C27H30O2S2 and a molecular weight of 450.67 g/mol. Its IUPAC name is ethyl 2-(2-phenylethyl)-5,5-bis(phenylsulfanyl)pentanoate.
| Compound Name | ethyl 2-(2-phenylethyl)-5,5-bis(phenylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 15501159 |
| Molecular Formula | C27H30O2S2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | ethyl 2-(2-phenylethyl)-5,5-bis(phenylsulfanyl)pentanoate |
| SMILES | CCOC(=O)C(CCc1ccccc1)CCC(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C27H30O2S2/c1-2-29-27(28)23(19-18-22-12-6-3-7-13-22)20-21-26(30-24-14-8-4-9-15-24)31-25-16-10-5-11-17-25/h3-17,23,26H,2,18-21H2,1H3 |
| InChIKey | TVDNGQQSVXTKCN-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|