C24H29NO8S2 — CID 135055305
ethyl 4,4-bis(benzenesulfonyl)-2-cyano-2-(diethoxymethyl)butanoate (PubChem CID 135055305) has the molecular formula C24H29NO8S2 and a molecular weight of 523.63 g/mol. Its IUPAC name is ethyl 4,4-bis(benzenesulfonyl)-2-cyano-2-(diethoxymethyl)butanoate.
| Compound Name | ethyl 4,4-bis(benzenesulfonyl)-2-cyano-2-(diethoxymethyl)butanoate |
|---|---|
| PubChem CID | 135055305 |
| Molecular Formula | C24H29NO8S2 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | ethyl 4,4-bis(benzenesulfonyl)-2-cyano-2-(diethoxymethyl)butanoate |
| SMILES | CCOC(=O)C(C#N)(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)C(OCC)OCC |
| InChI | InChI=1S/C24H29NO8S2/c1-4-31-22(26)24(18-25,23(32-5-2)33-6-3)17-21(34(27,28)19-13-9-7-10-14-19)35(29,30)20-15-11-8-12-16-20/h7-16,21,23H,4-6,17H2,1-3H3 |
| InChIKey | XWQFYGPDPBPIQT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 136.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|