C25H31NO8S2 — CID 11671058
ethyl 2-[2,2-bis(benzenesulfonyl)ethyl]-2-cyano-4,4-diethoxybutanoate (PubChem CID 11671058) has the molecular formula C25H31NO8S2 and a molecular weight of 537.66 g/mol. Its IUPAC name is ethyl 2-[2,2-bis(benzenesulfonyl)ethyl]-2-cyano-4,4-diethoxybutanoate.
| Compound Name | ethyl 2-[2,2-bis(benzenesulfonyl)ethyl]-2-cyano-4,4-diethoxybutanoate |
|---|---|
| PubChem CID | 11671058 |
| Molecular Formula | C25H31NO8S2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | ethyl 2-[2,2-bis(benzenesulfonyl)ethyl]-2-cyano-4,4-diethoxybutanoate |
| SMILES | CCOC(=O)C(C#N)(CC(OCC)OCC)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H31NO8S2/c1-4-32-22(33-5-2)17-25(19-26,24(27)34-6-3)18-23(35(28,29)20-13-9-7-10-14-20)36(30,31)21-15-11-8-12-16-21/h7-16,22-23H,4-6,17-18H2,1-3H3 |
| InChIKey | GTAPPRTXFKLCKJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 136.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|