C15H19NO4S — CID 11130669
ethyl 4-(benzenesulfonyl)-4-cyano-3,3-dimethylbutanoate (PubChem CID 11130669) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is ethyl 4-(benzenesulfonyl)-4-cyano-3,3-dimethylbutanoate.
| Compound Name | ethyl 4-(benzenesulfonyl)-4-cyano-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 11130669 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | ethyl 4-(benzenesulfonyl)-4-cyano-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)CC(C)(C)C(C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO4S/c1-4-20-14(17)10-15(2,3)13(11-16)21(18,19)12-8-6-5-7-9-12/h5-9,13H,4,10H2,1-3H3 |
| InChIKey | GRAILCXIXGJZCF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |