C17H16N2O8S — CID 134835548
ethyl 3-(benzenesulfonyl)-3-(2,4-dinitrophenyl)propanoate (PubChem CID 134835548) has the molecular formula C17H16N2O8S and a molecular weight of 408.39 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonyl)-3-(2,4-dinitrophenyl)propanoate.
| Compound Name | ethyl 3-(benzenesulfonyl)-3-(2,4-dinitrophenyl)propanoate |
|---|---|
| PubChem CID | 134835548 |
| Molecular Formula | C17H16N2O8S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | ethyl 3-(benzenesulfonyl)-3-(2,4-dinitrophenyl)propanoate |
| SMILES | CCOC(=O)CC(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O8S/c1-2-27-17(20)11-16(28(25,26)13-6-4-3-5-7-13)14-9-8-12(18(21)22)10-15(14)19(23)24/h3-10,16H,2,11H2,1H3 |
| InChIKey | SKVKPPQLOKIDSZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|