C23H27NO6S — CID 40733935
ethyl (3S,4R)-4-(benzenesulfonyl)-4-cyano-2,2-diethoxy-3-phenylbutanoate (PubChem CID 40733935) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(benzenesulfonyl)-4-cyano-2,2-diethoxy-3-phenylbutanoate.
| Compound Name | ethyl (3S,4R)-4-(benzenesulfonyl)-4-cyano-2,2-diethoxy-3-phenylbutanoate |
|---|---|
| PubChem CID | 40733935 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | ethyl (3S,4R)-4-(benzenesulfonyl)-4-cyano-2,2-diethoxy-3-phenylbutanoate |
| SMILES | CCOC(=O)C(OCC)(OCC)[C@H](c1ccccc1)[C@H](C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H27NO6S/c1-4-28-22(25)23(29-5-2,30-6-3)21(18-13-9-7-10-14-18)20(17-24)31(26,27)19-15-11-8-12-16-19/h7-16,20-21H,4-6H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | WABJAUWEWNPYAR-LEWJYISDSA-N |
| XLogP | 3.47 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|