C25H32N2O5 — CID 101401342
ethyl (3S,5R)-5-cyano-2,2-diethoxy-5-(4-methoxyanilino)-3-phenylpentanoate (PubChem CID 101401342) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is ethyl (3S,5R)-5-cyano-2,2-diethoxy-5-(4-methoxyanilino)-3-phenylpentanoate.
| Compound Name | ethyl (3S,5R)-5-cyano-2,2-diethoxy-5-(4-methoxyanilino)-3-phenylpentanoate |
|---|---|
| PubChem CID | 101401342 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | ethyl (3S,5R)-5-cyano-2,2-diethoxy-5-(4-methoxyanilino)-3-phenylpentanoate |
| SMILES | CCOC(=O)C(OCC)(OCC)[C@@H](C[C@H](C#N)Nc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O5/c1-5-30-24(28)25(31-6-2,32-7-3)23(19-11-9-8-10-12-19)17-21(18-26)27-20-13-15-22(29-4)16-14-20/h8-16,21,23,27H,5-7,17H2,1-4H3/t21-,23+/m1/s1 |
| InChIKey | AXLJBCLSNXOTDN-GGAORHGYSA-N |
| XLogP | 4.51 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|