C20H23NO8S2 — CID 53343251
ethyl 4,4-bis(benzenesulfonyl)-2-ethyl-2-nitrobutanoate (PubChem CID 53343251) has the molecular formula C20H23NO8S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 4,4-bis(benzenesulfonyl)-2-ethyl-2-nitrobutanoate.
| Compound Name | ethyl 4,4-bis(benzenesulfonyl)-2-ethyl-2-nitrobutanoate |
|---|---|
| PubChem CID | 53343251 |
| Molecular Formula | C20H23NO8S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | ethyl 4,4-bis(benzenesulfonyl)-2-ethyl-2-nitrobutanoate |
| SMILES | CCOC(=O)C(CC)(CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C20H23NO8S2/c1-3-20(21(23)24,19(22)29-4-2)15-18(30(25,26)16-11-7-5-8-12-16)31(27,28)17-13-9-6-10-14-17/h5-14,18H,3-4,15H2,1-2H3 |
| InChIKey | QKICXKDGYNVOJJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 137.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|